C16H22BrClN2O — CID 107952216
3-bromo-5-chloro-N-[[1-(dimethylamino)cyclohexyl]methyl]benzamide (PubChem CID 107952216) has the molecular formula C16H22BrClN2O and a molecular weight of 373.72 g/mol. Its IUPAC name is 3-bromo-5-chloro-N-[[1-(dimethylamino)cyclohexyl]methyl]benzamide.
| Compound Name | 3-bromo-5-chloro-N-[[1-(dimethylamino)cyclohexyl]methyl]benzamide |
|---|---|
| PubChem CID | 107952216 |
| Molecular Formula | C16H22BrClN2O |
| Molecular Weight | 373.72 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | 3-bromo-5-chloro-N-[[1-(dimethylamino)cyclohexyl]methyl]benzamide |
| SMILES | CN(C)C1(CNC(=O)c2cc(Cl)cc(Br)c2)CCCCC1 |
| InChI | InChI=1S/C16H22BrClN2O/c1-20(2)16(6-4-3-5-7-16)11-19-15(21)12-8-13(17)10-14(18)9-12/h8-10H,3-7,11H2,1-2H3,(H,19,21) |
| InChIKey | FYXXUUMIEOJZOQ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.72 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |