C13H15BrClNOS — CID 107952902
3-bromo-5-chloro-N-[(2-methylthiolan-2-yl)methyl]benzamide (PubChem CID 107952902) has the molecular formula C13H15BrClNOS and a molecular weight of 348.69 g/mol. Its IUPAC name is 3-bromo-5-chloro-N-[(2-methylthiolan-2-yl)methyl]benzamide.
| Compound Name | 3-bromo-5-chloro-N-[(2-methylthiolan-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 107952902 |
| Molecular Formula | C13H15BrClNOS |
| Molecular Weight | 348.69 g/mol |
| Exact Mass | 346.97 |
| IUPAC Name | 3-bromo-5-chloro-N-[(2-methylthiolan-2-yl)methyl]benzamide |
| SMILES | CC1(CNC(=O)c2cc(Cl)cc(Br)c2)CCCS1 |
| InChI | InChI=1S/C13H15BrClNOS/c1-13(3-2-4-18-13)8-16-12(17)9-5-10(14)7-11(15)6-9/h5-7H,2-4,8H2,1H3,(H,16,17) |
| InChIKey | CKTCUKPHIKQVRU-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.69 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |