C13H17NO3S — CID 113347322
3,5-dihydroxy-N-[(2-methylthiolan-2-yl)methyl]benzamide (PubChem CID 113347322) has the molecular formula C13H17NO3S and a molecular weight of 267.35 g/mol. Its IUPAC name is 3,5-dihydroxy-N-[(2-methylthiolan-2-yl)methyl]benzamide.
| Compound Name | 3,5-dihydroxy-N-[(2-methylthiolan-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 113347322 |
| Molecular Formula | C13H17NO3S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 3,5-dihydroxy-N-[(2-methylthiolan-2-yl)methyl]benzamide |
| SMILES | CC1(CNC(=O)c2cc(O)cc(O)c2)CCCS1 |
| InChI | InChI=1S/C13H17NO3S/c1-13(3-2-4-18-13)8-14-12(17)9-5-10(15)7-11(16)6-9/h5-7,15-16H,2-4,8H2,1H3,(H,14,17) |
| InChIKey | HTLZHOHTXRFVOY-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |