C13H18N2O2S — CID 103757770
6-methyl-N-[(2-methylthiolan-2-yl)methyl]-4-oxo-1H-pyridine-3-carboxamide (PubChem CID 103757770) has the molecular formula C13H18N2O2S and a molecular weight of 266.37 g/mol. Its IUPAC name is 6-methyl-N-[(2-methylthiolan-2-yl)methyl]-4-oxo-1H-pyridine-3-carboxamide.
| Compound Name | 6-methyl-N-[(2-methylthiolan-2-yl)methyl]-4-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 103757770 |
| Molecular Formula | C13H18N2O2S |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 6-methyl-N-[(2-methylthiolan-2-yl)methyl]-4-oxo-1H-pyridine-3-carboxamide |
| SMILES | Cc1cc(=O)c(C(=O)NCC2(C)CCCS2)c[nH]1 |
| InChI | InChI=1S/C13H18N2O2S/c1-9-6-11(16)10(7-14-9)12(17)15-8-13(2)4-3-5-18-13/h6-7H,3-5,8H2,1-2H3,(H,14,16)(H,15,17) |
| InChIKey | FWFBQHVLKFWJNL-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |