C18H28N2O3 — CID 111539116
N-[(4-tert-butyl-1-hydroxycyclohexyl)methyl]-6-methyl-4-oxo-1H-pyridine-3-carboxamide (PubChem CID 111539116) has the molecular formula C18H28N2O3 and a molecular weight of 320.43 g/mol. Its IUPAC name is N-[(4-tert-butyl-1-hydroxycyclohexyl)methyl]-6-methyl-4-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-[(4-tert-butyl-1-hydroxycyclohexyl)methyl]-6-methyl-4-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 111539116 |
| Molecular Formula | C18H28N2O3 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | N-[(4-tert-butyl-1-hydroxycyclohexyl)methyl]-6-methyl-4-oxo-1H-pyridine-3-carboxamide |
| SMILES | Cc1cc(=O)c(C(=O)NCC2(O)CCC(C(C)(C)C)CC2)c[nH]1 |
| InChI | InChI=1S/C18H28N2O3/c1-12-9-15(21)14(10-19-12)16(22)20-11-18(23)7-5-13(6-8-18)17(2,3)4/h9-10,13,23H,5-8,11H2,1-4H3,(H,19,21)(H,20,22) |
| InChIKey | XIOCAJQRMCXLNG-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |