C16H19FN2OS — CID 80744611
2-(3-aminoprop-1-ynyl)-4-fluoro-N-[(2-methylthiolan-2-yl)methyl]benzamide (PubChem CID 80744611) has the molecular formula C16H19FN2OS and a molecular weight of 306.41 g/mol. Its IUPAC name is 2-(3-aminoprop-1-ynyl)-4-fluoro-N-[(2-methylthiolan-2-yl)methyl]benzamide.
| Compound Name | 2-(3-aminoprop-1-ynyl)-4-fluoro-N-[(2-methylthiolan-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 80744611 |
| Molecular Formula | C16H19FN2OS |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 2-(3-aminoprop-1-ynyl)-4-fluoro-N-[(2-methylthiolan-2-yl)methyl]benzamide |
| SMILES | CC1(CNC(=O)c2ccc(F)cc2C#CCN)CCCS1 |
| InChI | InChI=1S/C16H19FN2OS/c1-16(7-3-9-21-16)11-19-15(20)14-6-5-13(17)10-12(14)4-2-8-18/h5-6,10H,3,7-9,11,18H2,1H3,(H,19,20) |
| InChIKey | DTPHDLLDTRYDBJ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|