C14H17NO3S — CID 124592899
3-[[(2R)-2-methylthiolan-2-yl]methylcarbamoyl]benzoic acid (PubChem CID 124592899) has the molecular formula C14H17NO3S and a molecular weight of 279.36 g/mol. Its IUPAC name is 3-[[(2R)-2-methylthiolan-2-yl]methylcarbamoyl]benzoic acid.
| Compound Name | 3-[[(2R)-2-methylthiolan-2-yl]methylcarbamoyl]benzoic acid |
|---|---|
| PubChem CID | 124592899 |
| Molecular Formula | C14H17NO3S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 3-[[(2R)-2-methylthiolan-2-yl]methylcarbamoyl]benzoic acid |
| SMILES | C[C@]1(CNC(=O)c2cccc(C(=O)O)c2)CCCS1 |
| InChI | InChI=1S/C14H17NO3S/c1-14(6-3-7-19-14)9-15-12(16)10-4-2-5-11(8-10)13(17)18/h2,4-5,8H,3,6-7,9H2,1H3,(H,15,16)(H,17,18)/t14-/m1/s1 |
| InChIKey | KRMNNFJMEUCCCJ-CQSZACIVSA-N |
| XLogP | 2.40 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |