C16H22BrNO3 — CID 103969819
N-[[1-(bromomethyl)cyclohexyl]methyl]-2-hydroxy-5-methoxybenzamide (PubChem CID 103969819) has the molecular formula C16H22BrNO3 and a molecular weight of 356.26 g/mol. Its IUPAC name is N-[[1-(bromomethyl)cyclohexyl]methyl]-2-hydroxy-5-methoxybenzamide.
| Compound Name | N-[[1-(bromomethyl)cyclohexyl]methyl]-2-hydroxy-5-methoxybenzamide |
|---|---|
| PubChem CID | 103969819 |
| Molecular Formula | C16H22BrNO3 |
| Molecular Weight | 356.26 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | N-[[1-(bromomethyl)cyclohexyl]methyl]-2-hydroxy-5-methoxybenzamide |
| SMILES | COc1ccc(O)c(C(=O)NCC2(CBr)CCCCC2)c1 |
| InChI | InChI=1S/C16H22BrNO3/c1-21-12-5-6-14(19)13(9-12)15(20)18-11-16(10-17)7-3-2-4-8-16/h5-6,9,19H,2-4,7-8,10-11H2,1H3,(H,18,20) |
| InChIKey | RXPVAWCLAZLYBT-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.26 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|