C10H12O3 — CID 23094385
1-(2,3-dihydroxyphenyl)butan-1-one (PubChem CID 23094385) has the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. Its IUPAC name is 1-(2,3-dihydroxyphenyl)butan-1-one.
| Compound Name | 1-(2,3-dihydroxyphenyl)butan-1-one |
|---|---|
| PubChem CID | 23094385 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 1-(2,3-dihydroxyphenyl)butan-1-one |
| SMILES | CCCC(=O)c1cccc(O)c1O |
| InChI | InChI=1S/C10H12O3/c1-2-4-8(11)7-5-3-6-9(12)10(7)13/h3,5-6,12-13H,2,4H2,1H3 |
| InChIKey | PBJOJUHIGRHRCQ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|