C22H34O7 — CID 158773669
4-butylbenzene-1,2,3-triol;methane;1-(2,3,4-trihydroxyphenyl)butan-1-one (PubChem CID 158773669) has the molecular formula C22H34O7 and a molecular weight of 410.51 g/mol. Its IUPAC name is 4-butylbenzene-1,2,3-triol;methane;1-(2,3,4-trihydroxyphenyl)butan-1-one.
| Compound Name | 4-butylbenzene-1,2,3-triol;methane;1-(2,3,4-trihydroxyphenyl)butan-1-one |
|---|---|
| PubChem CID | 158773669 |
| Molecular Formula | C22H34O7 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | 4-butylbenzene-1,2,3-triol;methane;1-(2,3,4-trihydroxyphenyl)butan-1-one |
| SMILES | C.C.CCCC(=O)c1ccc(O)c(O)c1O.CCCCc1ccc(O)c(O)c1O |
| InChI | InChI=1S/C10H12O4.C10H14O3.2CH4/c1-2-3-7(11)6-4-5-8(12)10(14)9(6)13;1-2-3-4-7-5-6-8(11)10(13)9(7)12;;/h4-5,12-14H,2-3H2,1H3;5-6,11-13H,2-4H2,1H3;2*1H4 |
| InChIKey | IQEUYYKFCMPTIF-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|