C24H30N2O5 — CID 67641010
N'-(4-butanoyl-3-hydroxyphenyl)-N-(4-butyl-3-hydroxyphenyl)butanediamide (PubChem CID 67641010) has the molecular formula C24H30N2O5 and a molecular weight of 426.51 g/mol. Its IUPAC name is N'-(4-butanoyl-3-hydroxyphenyl)-N-(4-butyl-3-hydroxyphenyl)butanediamide.
| Compound Name | N'-(4-butanoyl-3-hydroxyphenyl)-N-(4-butyl-3-hydroxyphenyl)butanediamide |
|---|---|
| PubChem CID | 67641010 |
| Molecular Formula | C24H30N2O5 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | N'-(4-butanoyl-3-hydroxyphenyl)-N-(4-butyl-3-hydroxyphenyl)butanediamide |
| SMILES | CCCCc1ccc(NC(=O)CCC(=O)Nc2ccc(C(=O)CCC)c(O)c2)cc1O |
| InChI | InChI=1S/C24H30N2O5/c1-3-5-7-16-8-9-17(14-21(16)28)25-23(30)12-13-24(31)26-18-10-11-19(22(29)15-18)20(27)6-4-2/h8-11,14-15,28-29H,3-7,12-13H2,1-2H3,(H,25,30)(H,26,31) |
| InChIKey | XBMOBXXRMSAGMG-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |