C24H32N2O5 — CID 67641008
N-(4-butanoyl-3-hydroxyphenyl)acetamide;N-(4-butyl-3-hydroxyphenyl)acetamide (PubChem CID 67641008) has the molecular formula C24H32N2O5 and a molecular weight of 428.53 g/mol. Its IUPAC name is N-(4-butanoyl-3-hydroxyphenyl)acetamide;N-(4-butyl-3-hydroxyphenyl)acetamide.
| Compound Name | N-(4-butanoyl-3-hydroxyphenyl)acetamide;N-(4-butyl-3-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 67641008 |
| Molecular Formula | C24H32N2O5 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | N-(4-butanoyl-3-hydroxyphenyl)acetamide;N-(4-butyl-3-hydroxyphenyl)acetamide |
| SMILES | CCCC(=O)c1ccc(NC(C)=O)cc1O.CCCCc1ccc(NC(C)=O)cc1O |
| InChI | InChI=1S/C12H15NO3.C12H17NO2/c1-3-4-11(15)10-6-5-9(7-12(10)16)13-8(2)14;1-3-4-5-10-6-7-11(8-12(10)15)13-9(2)14/h5-7,16H,3-4H2,1-2H3,(H,13,14);6-8,15H,3-5H2,1-2H3,(H,13,14) |
| InChIKey | PUGXMAPGDZVLOL-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |