C8H9NO3 — CID 89392484
2-amino-1-(2,3-dihydroxyphenyl)ethanone (PubChem CID 89392484) has the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. Its IUPAC name is 2-amino-1-(2,3-dihydroxyphenyl)ethanone.
| Compound Name | 2-amino-1-(2,3-dihydroxyphenyl)ethanone |
|---|---|
| PubChem CID | 89392484 |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.16 g/mol |
| Exact Mass | 167.06 |
| IUPAC Name | 2-amino-1-(2,3-dihydroxyphenyl)ethanone |
| SMILES | NCC(=O)c1cccc(O)c1O |
| InChI | InChI=1S/C8H9NO3/c9-4-7(11)5-2-1-3-6(10)8(5)12/h1-3,10,12H,4,9H2 |
| InChIKey | ZNDKVRMHECOXLA-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.16 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|