C16H14O4 — CID 3624355
1,4-bis(2-hydroxyphenyl)butane-1,4-dione (PubChem CID 3624355) has the molecular formula C16H14O4 and a molecular weight of 270.28 g/mol. Its IUPAC name is 1,4-bis(2-hydroxyphenyl)butane-1,4-dione.
| Compound Name | 1,4-bis(2-hydroxyphenyl)butane-1,4-dione |
|---|---|
| PubChem CID | 3624355 |
| Molecular Formula | C16H14O4 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 1,4-bis(2-hydroxyphenyl)butane-1,4-dione |
| SMILES | O=C(CCC(=O)c1ccccc1O)c1ccccc1O |
| InChI | InChI=1S/C16H14O4/c17-13-7-3-1-5-11(13)15(19)9-10-16(20)12-6-2-4-8-14(12)18/h1-8,17-18H,9-10H2 |
| InChIKey | NJMFMNQOHLRWQY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |