C10H12N2O4 — CID 170860296
2-amino-1-[5-(2-aminoacetyl)-2,4-dihydroxyphenyl]ethanone (PubChem CID 170860296) has the molecular formula C10H12N2O4 and a molecular weight of 224.22 g/mol. Its IUPAC name is 2-amino-1-[5-(2-aminoacetyl)-2,4-dihydroxyphenyl]ethanone.
| Compound Name | 2-amino-1-[5-(2-aminoacetyl)-2,4-dihydroxyphenyl]ethanone |
|---|---|
| PubChem CID | 170860296 |
| Molecular Formula | C10H12N2O4 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 2-amino-1-[5-(2-aminoacetyl)-2,4-dihydroxyphenyl]ethanone |
| SMILES | NCC(=O)c1cc(C(=O)CN)c(O)cc1O |
| InChI | InChI=1S/C10H12N2O4/c11-3-9(15)5-1-6(10(16)4-12)8(14)2-7(5)13/h1-2,13-14H,3-4,11-12H2 |
| InChIKey | XMRITORSBYLUFW-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |