C8H8ClF2NO — CID 122360971
2-amino-1-(2,3-difluorophenyl)ethanone;hydrochloride (PubChem CID 122360971) has the molecular formula C8H8ClF2NO and a molecular weight of 207.61 g/mol. Its IUPAC name is 2-amino-1-(2,3-difluorophenyl)ethanone;hydrochloride.
| Compound Name | 2-amino-1-(2,3-difluorophenyl)ethanone;hydrochloride |
|---|---|
| PubChem CID | 122360971 |
| Molecular Formula | C8H8ClF2NO |
| Molecular Weight | 207.61 g/mol |
| Exact Mass | 207.03 |
| IUPAC Name | 2-amino-1-(2,3-difluorophenyl)ethanone;hydrochloride |
| SMILES | Cl.NCC(=O)c1cccc(F)c1F |
| InChI | InChI=1S/C8H7F2NO.ClH/c9-6-3-1-2-5(8(6)10)7(12)4-11;/h1-3H,4,11H2;1H |
| InChIKey | AWAAZOCTXISYME-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.61 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |