C10H8F2O — CID 116659426
1-(2,3-difluorophenyl)but-3-en-1-one (PubChem CID 116659426) has the molecular formula C10H8F2O and a molecular weight of 182.17 g/mol. Its IUPAC name is 1-(2,3-difluorophenyl)but-3-en-1-one.
| Compound Name | 1-(2,3-difluorophenyl)but-3-en-1-one |
|---|---|
| PubChem CID | 116659426 |
| Molecular Formula | C10H8F2O |
| Molecular Weight | 182.17 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | 1-(2,3-difluorophenyl)but-3-en-1-one |
| SMILES | C=CCC(=O)c1cccc(F)c1F |
| InChI | InChI=1S/C10H8F2O/c1-2-4-9(13)7-5-3-6-8(11)10(7)12/h2-3,5-6H,1,4H2 |
| InChIKey | APGNFKSFRQJERX-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.17 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|