C9H10FNO3 — CID 130478170
N-(2-fluoroethyl)-2,3-dihydroxybenzamide (PubChem CID 130478170) has the molecular formula C9H10FNO3 and a molecular weight of 199.18 g/mol. Its IUPAC name is N-(2-fluoroethyl)-2,3-dihydroxybenzamide.
| Compound Name | N-(2-fluoroethyl)-2,3-dihydroxybenzamide |
|---|---|
| PubChem CID | 130478170 |
| Molecular Formula | C9H10FNO3 |
| Molecular Weight | 199.18 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | N-(2-fluoroethyl)-2,3-dihydroxybenzamide |
| SMILES | O=C(NCCF)c1cccc(O)c1O |
| InChI | InChI=1S/C9H10FNO3/c10-4-5-11-9(14)6-2-1-3-7(12)8(6)13/h1-3,12-13H,4-5H2,(H,11,14) |
| InChIKey | LZZZPCDLDYJHNN-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.18 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|