C9H10FNO3 — CID 130504504
N-(2-fluoroethyl)-2,5-dihydroxybenzamide (PubChem CID 130504504) has the molecular formula C9H10FNO3 and a molecular weight of 199.18 g/mol. Its IUPAC name is N-(2-fluoroethyl)-2,5-dihydroxybenzamide.
| Compound Name | N-(2-fluoroethyl)-2,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 130504504 |
| Molecular Formula | C9H10FNO3 |
| Molecular Weight | 199.18 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | N-(2-fluoroethyl)-2,5-dihydroxybenzamide |
| SMILES | O=C(NCCF)c1cc(O)ccc1O |
| InChI | InChI=1S/C9H10FNO3/c10-3-4-11-9(14)7-5-6(12)1-2-8(7)13/h1-2,5,12-13H,3-4H2,(H,11,14) |
| InChIKey | NJNQTAQFGRGDCM-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.18 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|