C11H16N2O3 — CID 107725067
N-[2-(ethylamino)ethyl]-2,5-dihydroxybenzamide (PubChem CID 107725067) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is N-[2-(ethylamino)ethyl]-2,5-dihydroxybenzamide.
| Compound Name | N-[2-(ethylamino)ethyl]-2,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 107725067 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | N-[2-(ethylamino)ethyl]-2,5-dihydroxybenzamide |
| SMILES | CCNCCNC(=O)c1cc(O)ccc1O |
| InChI | InChI=1S/C11H16N2O3/c1-2-12-5-6-13-11(16)9-7-8(14)3-4-10(9)15/h3-4,7,12,14-15H,2,5-6H2,1H3,(H,13,16) |
| InChIKey | PHQSXUUEPFBNLE-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|