C11H14ClNO3 — CID 107726261
N-(4-chlorobutyl)-2,5-dihydroxybenzamide (PubChem CID 107726261) has the molecular formula C11H14ClNO3 and a molecular weight of 243.69 g/mol. Its IUPAC name is N-(4-chlorobutyl)-2,5-dihydroxybenzamide.
| Compound Name | N-(4-chlorobutyl)-2,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 107726261 |
| Molecular Formula | C11H14ClNO3 |
| Molecular Weight | 243.69 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | N-(4-chlorobutyl)-2,5-dihydroxybenzamide |
| SMILES | O=C(NCCCCCl)c1cc(O)ccc1O |
| InChI | InChI=1S/C11H14ClNO3/c12-5-1-2-6-13-11(16)9-7-8(14)3-4-10(9)15/h3-4,7,14-15H,1-2,5-6H2,(H,13,16) |
| InChIKey | GUOAPHSBXCMSBX-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.69 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|