C12H16ClNO3 — CID 107725987
N-(4-chloro-2-methylbutyl)-2,5-dihydroxybenzamide (PubChem CID 107725987) has the molecular formula C12H16ClNO3 and a molecular weight of 257.72 g/mol. Its IUPAC name is N-(4-chloro-2-methylbutyl)-2,5-dihydroxybenzamide.
| Compound Name | N-(4-chloro-2-methylbutyl)-2,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 107725987 |
| Molecular Formula | C12H16ClNO3 |
| Molecular Weight | 257.72 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | N-(4-chloro-2-methylbutyl)-2,5-dihydroxybenzamide |
| SMILES | CC(CCCl)CNC(=O)c1cc(O)ccc1O |
| InChI | InChI=1S/C12H16ClNO3/c1-8(4-5-13)7-14-12(17)10-6-9(15)2-3-11(10)16/h2-3,6,8,15-16H,4-5,7H2,1H3,(H,14,17) |
| InChIKey | QFULDBUIYRRSNM-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.72 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|