C15H14ClNO3 — CID 107725957
N-[[3-(chloromethyl)phenyl]methyl]-2,5-dihydroxybenzamide (PubChem CID 107725957) has the molecular formula C15H14ClNO3 and a molecular weight of 291.73 g/mol. Its IUPAC name is N-[[3-(chloromethyl)phenyl]methyl]-2,5-dihydroxybenzamide.
| Compound Name | N-[[3-(chloromethyl)phenyl]methyl]-2,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 107725957 |
| Molecular Formula | C15H14ClNO3 |
| Molecular Weight | 291.73 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | N-[[3-(chloromethyl)phenyl]methyl]-2,5-dihydroxybenzamide |
| SMILES | O=C(NCc1cccc(CCl)c1)c1cc(O)ccc1O |
| InChI | InChI=1S/C15H14ClNO3/c16-8-10-2-1-3-11(6-10)9-17-15(20)13-7-12(18)4-5-14(13)19/h1-7,18-19H,8-9H2,(H,17,20) |
| InChIKey | RJWUUXQJWZKFND-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.73 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|