C9H8N2O3 — CID 103892329
N-(cyanomethyl)-2,5-dihydroxybenzamide (PubChem CID 103892329) has the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. Its IUPAC name is N-(cyanomethyl)-2,5-dihydroxybenzamide.
| Compound Name | N-(cyanomethyl)-2,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 103892329 |
| Molecular Formula | C9H8N2O3 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | N-(cyanomethyl)-2,5-dihydroxybenzamide |
| SMILES | N#CCNC(=O)c1cc(O)ccc1O |
| InChI | InChI=1S/C9H8N2O3/c10-3-4-11-9(14)7-5-6(12)1-2-8(7)13/h1-2,5,12-13H,4H2,(H,11,14) |
| InChIKey | KUFKUGYDTCAGPK-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 93.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|