C14H11NO6 — CID 91463347
N-(2,5-dihydroxybenzoyl)-2,5-dihydroxybenzamide (PubChem CID 91463347) has the molecular formula C14H11NO6 and a molecular weight of 289.24 g/mol. Its IUPAC name is N-(2,5-dihydroxybenzoyl)-2,5-dihydroxybenzamide.
| Compound Name | N-(2,5-dihydroxybenzoyl)-2,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 91463347 |
| Molecular Formula | C14H11NO6 |
| Molecular Weight | 289.24 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | N-(2,5-dihydroxybenzoyl)-2,5-dihydroxybenzamide |
| SMILES | O=C(NC(=O)c1cc(O)ccc1O)c1cc(O)ccc1O |
| InChI | InChI=1S/C14H11NO6/c16-7-1-3-11(18)9(5-7)13(20)15-14(21)10-6-8(17)2-4-12(10)19/h1-6,16-19H,(H,15,20,21) |
| InChIKey | FKOOMOBODDERBV-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.24 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|