C14H10O8 — CID 151078353
(2,3-dihydroxybenzoyl) 2,3-dihydroxybenzenecarboperoxoate (PubChem CID 151078353) has the molecular formula C14H10O8 and a molecular weight of 306.23 g/mol. Its IUPAC name is (2,3-dihydroxybenzoyl) 2,3-dihydroxybenzenecarboperoxoate.
| Compound Name | (2,3-dihydroxybenzoyl) 2,3-dihydroxybenzenecarboperoxoate |
|---|---|
| PubChem CID | 151078353 |
| Molecular Formula | C14H10O8 |
| Molecular Weight | 306.23 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | (2,3-dihydroxybenzoyl) 2,3-dihydroxybenzenecarboperoxoate |
| SMILES | O=C(OOC(=O)c1cccc(O)c1O)c1cccc(O)c1O |
| InChI | InChI=1S/C14H10O8/c15-9-5-1-3-7(11(9)17)13(19)21-22-14(20)8-4-2-6-10(16)12(8)18/h1-6,15-18H |
| InChIKey | MJPALGBLHLHGRA-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.23 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|