C13H10O6 — CID 14094133
(2,3-dihydroxyphenyl)-(3,4,5-trihydroxyphenyl)methanone (PubChem CID 14094133) has the molecular formula C13H10O6 and a molecular weight of 262.22 g/mol. Its IUPAC name is (2,3-dihydroxyphenyl)-(3,4,5-trihydroxyphenyl)methanone.
| Compound Name | (2,3-dihydroxyphenyl)-(3,4,5-trihydroxyphenyl)methanone |
|---|---|
| PubChem CID | 14094133 |
| Molecular Formula | C13H10O6 |
| Molecular Weight | 262.22 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | (2,3-dihydroxyphenyl)-(3,4,5-trihydroxyphenyl)methanone |
| SMILES | O=C(c1cc(O)c(O)c(O)c1)c1cccc(O)c1O |
| InChI | InChI=1S/C13H10O6/c14-8-3-1-2-7(12(8)18)11(17)6-4-9(15)13(19)10(16)5-6/h1-5,14-16,18-19H |
| InChIKey | LMZNOSFQBKBMNN-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.22 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|