C29H28O7S — CID 68741991
(2,3-dihydroxyphenyl)-phenylmethanone;4-(4-hydroxy-3,5-dimethylphenyl)sulfonyl-2,6-dimethylphenol (PubChem CID 68741991) has the molecular formula C29H28O7S and a molecular weight of 520.60 g/mol. Its IUPAC name is (2,3-dihydroxyphenyl)-phenylmethanone;4-(4-hydroxy-3,5-dimethylphenyl)sulfonyl-2,6-dimethylphenol.
| Compound Name | (2,3-dihydroxyphenyl)-phenylmethanone;4-(4-hydroxy-3,5-dimethylphenyl)sulfonyl-2,6-dimethylphenol |
|---|---|
| PubChem CID | 68741991 |
| Molecular Formula | C29H28O7S |
| Molecular Weight | 520.60 g/mol |
| Exact Mass | 520.16 |
| IUPAC Name | (2,3-dihydroxyphenyl)-phenylmethanone;4-(4-hydroxy-3,5-dimethylphenyl)sulfonyl-2,6-dimethylphenol |
| SMILES | Cc1cc(S(=O)(=O)c2cc(C)c(O)c(C)c2)cc(C)c1O.O=C(c1ccccc1)c1cccc(O)c1O |
| InChI | InChI=1S/C16H18O4S.C13H10O3/c1-9-5-13(6-10(2)15(9)17)21(19,20)14-7-11(3)16(18)12(4)8-14;14-11-8-4-7-10(13(11)16)12(15)9-5-2-1-3-6-9/h5-8,17-18H,1-4H3;1-8,14,16H |
| InChIKey | ZZGAJSGMDJQJSY-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.60 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|