C14H10O3 — CID 135589785
3-benzoyl-2-hydroxycyclohepta-2,4,6-trien-1-one (PubChem CID 135589785) has the molecular formula C14H10O3 and a molecular weight of 226.23 g/mol. Its IUPAC name is 3-benzoyl-2-hydroxycyclohepta-2,4,6-trien-1-one.
| Compound Name | 3-benzoyl-2-hydroxycyclohepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 135589785 |
| Molecular Formula | C14H10O3 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 3-benzoyl-2-hydroxycyclohepta-2,4,6-trien-1-one |
| SMILES | O=C(c1ccccc1)c1ccccc(=O)c1O |
| InChI | InChI=1S/C14H10O3/c15-12-9-5-4-8-11(14(12)17)13(16)10-6-2-1-3-7-10/h1-9H,(H,15,17) |
| InChIKey | XSRNVBZNPXTFSI-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |