C13H12ClNO3 — CID 70538828
(3-amino-2,4-dihydroxyphenyl)-phenylmethanone;hydrochloride (PubChem CID 70538828) has the molecular formula C13H12ClNO3 and a molecular weight of 265.70 g/mol. Its IUPAC name is (3-amino-2,4-dihydroxyphenyl)-phenylmethanone;hydrochloride.
| Compound Name | (3-amino-2,4-dihydroxyphenyl)-phenylmethanone;hydrochloride |
|---|---|
| PubChem CID | 70538828 |
| Molecular Formula | C13H12ClNO3 |
| Molecular Weight | 265.70 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | (3-amino-2,4-dihydroxyphenyl)-phenylmethanone;hydrochloride |
| SMILES | Cl.Nc1c(O)ccc(C(=O)c2ccccc2)c1O |
| InChI | InChI=1S/C13H11NO3.ClH/c14-11-10(15)7-6-9(13(11)17)12(16)8-4-2-1-3-5-8;/h1-7,15,17H,14H2;1H |
| InChIKey | YNBXZGXZKRNOAC-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.70 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|