C13H9NO4 — CID 166883614
(3,4-dihydroxy-2-nitrosophenyl)-phenylmethanone (PubChem CID 166883614) has the molecular formula C13H9NO4 and a molecular weight of 243.22 g/mol. Its IUPAC name is (3,4-dihydroxy-2-nitrosophenyl)-phenylmethanone.
| Compound Name | (3,4-dihydroxy-2-nitrosophenyl)-phenylmethanone |
|---|---|
| PubChem CID | 166883614 |
| Molecular Formula | C13H9NO4 |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | (3,4-dihydroxy-2-nitrosophenyl)-phenylmethanone |
| SMILES | O=Nc1c(C(=O)c2ccccc2)ccc(O)c1O |
| InChI | InChI=1S/C13H9NO4/c15-10-7-6-9(11(14-18)13(10)17)12(16)8-4-2-1-3-5-8/h1-7,15,17H |
| InChIKey | ABVMAOWAQYRHIX-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 86.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|