C24H16O4 — CID 139061724
(8-benzoyl-2,7-dihydroxynaphthalen-1-yl)-phenylmethanone (PubChem CID 139061724) has the molecular formula C24H16O4 and a molecular weight of 368.39 g/mol. Its IUPAC name is (8-benzoyl-2,7-dihydroxynaphthalen-1-yl)-phenylmethanone.
| Compound Name | (8-benzoyl-2,7-dihydroxynaphthalen-1-yl)-phenylmethanone |
|---|---|
| PubChem CID | 139061724 |
| Molecular Formula | C24H16O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | (8-benzoyl-2,7-dihydroxynaphthalen-1-yl)-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1c(O)ccc2ccc(O)c(C(=O)c3ccccc3)c12 |
| InChI | InChI=1S/C24H16O4/c25-18-13-11-15-12-14-19(26)22(24(28)17-9-5-2-6-10-17)20(15)21(18)23(27)16-7-3-1-4-8-16/h1-14,25-26H |
| InChIKey | QERHHYWFRWCKPY-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |