C36H24O4 — CID 139086935
(8-benzoyl-2,7-diphenoxynaphthalen-1-yl)-phenylmethanone (PubChem CID 139086935) has the molecular formula C36H24O4 and a molecular weight of 520.58 g/mol. Its IUPAC name is (8-benzoyl-2,7-diphenoxynaphthalen-1-yl)-phenylmethanone.
| Compound Name | (8-benzoyl-2,7-diphenoxynaphthalen-1-yl)-phenylmethanone |
|---|---|
| PubChem CID | 139086935 |
| Molecular Formula | C36H24O4 |
| Molecular Weight | 520.58 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | (8-benzoyl-2,7-diphenoxynaphthalen-1-yl)-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1c(Oc2ccccc2)ccc2ccc(Oc3ccccc3)c(C(=O)c3ccccc3)c12 |
| InChI | InChI=1S/C36H24O4/c37-35(26-13-5-1-6-14-26)33-30(39-28-17-9-3-10-18-28)23-21-25-22-24-31(40-29-19-11-4-12-20-29)34(32(25)33)36(38)27-15-7-2-8-16-27/h1-24H |
| InChIKey | CTPSMNSGVCDWLQ-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.58 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |