C38H24O6 — CID 139084342
(1,8-dibenzoyl-7-benzoyloxynaphthalen-2-yl) benzoate (PubChem CID 139084342) has the molecular formula C38H24O6 and a molecular weight of 576.60 g/mol. Its IUPAC name is (1,8-dibenzoyl-7-benzoyloxynaphthalen-2-yl) benzoate.
| Compound Name | (1,8-dibenzoyl-7-benzoyloxynaphthalen-2-yl) benzoate |
|---|---|
| PubChem CID | 139084342 |
| Molecular Formula | C38H24O6 |
| Molecular Weight | 576.60 g/mol |
| Exact Mass | 576.16 |
| IUPAC Name | (1,8-dibenzoyl-7-benzoyloxynaphthalen-2-yl) benzoate |
| SMILES | O=C(Oc1ccc2ccc(OC(=O)c3ccccc3)c(C(=O)c3ccccc3)c2c1C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H24O6/c39-35(26-13-5-1-6-14-26)33-30(43-37(41)28-17-9-3-10-18-28)23-21-25-22-24-31(44-38(42)29-19-11-4-12-20-29)34(32(25)33)36(40)27-15-7-2-8-16-27/h1-24H |
| InChIKey | TZHGHEPZLSVICH-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.60 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|