About (2-benzoyl-3-hydroxyphenyl) benzoate;2-methyloxirane
(2-benzoyl-3-hydroxyphenyl) benzoate;2-methyloxirane (PubChem CID 87616377) has the molecular formula C23H20O5
and a molecular weight of 376.41 g/mol. Its IUPAC name is (2-benzoyl-3-hydroxyphenyl) benzoate;2-methyloxirane.
Molecular Properties
| Compound Name | (2-benzoyl-3-hydroxyphenyl) benzoate;2-methyloxirane |
| PubChem CID | 87616377 |
| Molecular Formula | C23H20O5 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | (2-benzoyl-3-hydroxyphenyl) benzoate;2-methyloxirane |
| SMILES | CC1CO1.O=C(Oc1cccc(O)c1C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H14O4.C3H6O/c21-16-12-7-13-17(24-20(23)15-10-5-2-6-11-15)18(16)19(22)14-8-3-1-4-9-14;1-3-2-4-3/h1-13,21H;3H,2H2,1H3 |
| InChIKey | RLQZGVFWNOTDPN-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (2-benzoyl-3-hydroxyphenyl) benzoate;2-methyloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-benzoyl-3-hydroxyphenyl) benzoate;2-methyloxirane?
The IUPAC name of (2-benzoyl-3-hydroxyphenyl) benzoate;2-methyloxirane (CID 87616377) is (2-benzoyl-3-hydroxyphenyl) benzoate;2-methyloxirane.
What is the SMILES notation for (2-benzoyl-3-hydroxyphenyl) benzoate;2-methyloxirane?
The canonical SMILES for (2-benzoyl-3-hydroxyphenyl) benzoate;2-methyloxirane is CC1CO1.O=C(Oc1cccc(O)c1C(=O)c1ccccc1)c1ccccc1.
What is the InChIKey of (2-benzoyl-3-hydroxyphenyl) benzoate;2-methyloxirane?
The InChIKey is RLQZGVFWNOTDPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14O4.C3H6O/c21-16-12-7-13-17(24-20(23)15-10-5-2-6-11-15)18(16)19(22)14-8-3-1-4-9-14;1-3-2-4-3/h1-13,21H;3H,2H2,1H3.
What are the key properties of (2-benzoyl-3-hydroxyphenyl) benzoate;2-methyloxirane?
(2-benzoyl-3-hydroxyphenyl) benzoate;2-methyloxirane has a molecular weight of 376.41 g/mol, XLogP of 4.25, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-benzoyl-3-hydroxyphenyl) benzoate;2-methyloxirane is sourced from PubChem (CID 87616377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).