C36H26O10 — CID 144750320
diphenyl 3,6-bis[(4-methoxybenzoyl)oxy]benzene-1,2-dicarboxylate (PubChem CID 144750320) has the molecular formula C36H26O10 and a molecular weight of 618.59 g/mol. Its IUPAC name is diphenyl 3,6-bis[(4-methoxybenzoyl)oxy]benzene-1,2-dicarboxylate.
| Compound Name | diphenyl 3,6-bis[(4-methoxybenzoyl)oxy]benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 144750320 |
| Molecular Formula | C36H26O10 |
| Molecular Weight | 618.59 g/mol |
| Exact Mass | 618.15 |
| IUPAC Name | diphenyl 3,6-bis[(4-methoxybenzoyl)oxy]benzene-1,2-dicarboxylate |
| SMILES | COc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(OC)cc3)c(C(=O)Oc3ccccc3)c2C(=O)Oc2ccccc2)cc1 |
| InChI | InChI=1S/C36H26O10/c1-41-25-17-13-23(14-18-25)33(37)45-29-21-22-30(46-34(38)24-15-19-26(42-2)20-16-24)32(36(40)44-28-11-7-4-8-12-28)31(29)35(39)43-27-9-5-3-6-10-27/h3-22H,1-2H3 |
| InChIKey | PXVLXFGAILRASH-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.59 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|