C31H24O9 — CID 144750310
1-O-methyl 2-O-phenyl 3-(4-methoxybenzoyl)oxy-6-(3-methylbenzoyl)oxybenzene-1,2-dicarboxylate (PubChem CID 144750310) has the molecular formula C31H24O9 and a molecular weight of 540.52 g/mol. Its IUPAC name is 1-O-methyl 2-O-phenyl 3-(4-methoxybenzoyl)oxy-6-(3-methylbenzoyl)oxybenzene-1,2-dicarboxylate.
| Compound Name | 1-O-methyl 2-O-phenyl 3-(4-methoxybenzoyl)oxy-6-(3-methylbenzoyl)oxybenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 144750310 |
| Molecular Formula | C31H24O9 |
| Molecular Weight | 540.52 g/mol |
| Exact Mass | 540.14 |
| IUPAC Name | 1-O-methyl 2-O-phenyl 3-(4-methoxybenzoyl)oxy-6-(3-methylbenzoyl)oxybenzene-1,2-dicarboxylate |
| SMILES | COC(=O)c1c(OC(=O)c2cccc(C)c2)ccc(OC(=O)c2ccc(OC)cc2)c1C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C31H24O9/c1-19-8-7-9-21(18-19)29(33)40-24-16-17-25(39-28(32)20-12-14-22(36-2)15-13-20)27(26(24)30(34)37-3)31(35)38-23-10-5-4-6-11-23/h4-18H,1-3H3 |
| InChIKey | HBUHZCKDILLLGW-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.52 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|