C23H22O5S — CID 144914302
[4-(2,4-dimethylphenoxy)carbonylphenyl] 4-methoxybenzoate;sulfane (PubChem CID 144914302) has the molecular formula C23H22O5S and a molecular weight of 410.49 g/mol. Its IUPAC name is [4-(2,4-dimethylphenoxy)carbonylphenyl] 4-methoxybenzoate;sulfane.
| Compound Name | [4-(2,4-dimethylphenoxy)carbonylphenyl] 4-methoxybenzoate;sulfane |
|---|---|
| PubChem CID | 144914302 |
| Molecular Formula | C23H22O5S |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | [4-(2,4-dimethylphenoxy)carbonylphenyl] 4-methoxybenzoate;sulfane |
| SMILES | COc1ccc(C(=O)Oc2ccc(C(=O)Oc3ccc(C)cc3C)cc2)cc1.S |
| InChI | InChI=1S/C23H20O5.H2S/c1-15-4-13-21(16(2)14-15)28-23(25)18-7-11-20(12-8-18)27-22(24)17-5-9-19(26-3)10-6-17;/h4-14H,1-3H3;1H2 |
| InChIKey | XEWVWVQKCKFCLW-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|