C24H22O6 — CID 121297333
bis(2-methoxy-4-methylphenyl) benzene-1,4-dicarboxylate (PubChem CID 121297333) has the molecular formula C24H22O6 and a molecular weight of 406.43 g/mol. Its IUPAC name is bis(2-methoxy-4-methylphenyl) benzene-1,4-dicarboxylate.
| Compound Name | bis(2-methoxy-4-methylphenyl) benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 121297333 |
| Molecular Formula | C24H22O6 |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | bis(2-methoxy-4-methylphenyl) benzene-1,4-dicarboxylate |
| SMILES | COc1cc(C)ccc1OC(=O)c1ccc(C(=O)Oc2ccc(C)cc2OC)cc1 |
| InChI | InChI=1S/C24H22O6/c1-15-5-11-19(21(13-15)27-3)29-23(25)17-7-9-18(10-8-17)24(26)30-20-12-6-16(2)14-22(20)28-4/h5-14H,1-4H3 |
| InChIKey | GKZWHOOXIRFAFG-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|