About (5-methyl-2-propan-2-ylphenyl) 3-iodo-4-methoxybenzoate
(5-methyl-2-propan-2-ylphenyl) 3-iodo-4-methoxybenzoate (PubChem CID 23010933) has the molecular formula C18H19IO3
and a molecular weight of 410.25 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylphenyl) 3-iodo-4-methoxybenzoate.
Molecular Properties
| Compound Name | (5-methyl-2-propan-2-ylphenyl) 3-iodo-4-methoxybenzoate |
| PubChem CID | 23010933 |
| Molecular Formula | C18H19IO3 |
| Molecular Weight | 410.25 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | (5-methyl-2-propan-2-ylphenyl) 3-iodo-4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2cc(C)ccc2C(C)C)cc1I |
| InChI | InChI=1S/C18H19IO3/c1-11(2)14-7-5-12(3)9-17(14)22-18(20)13-6-8-16(21-4)15(19)10-13/h5-11H,1-4H3 |
| InChIKey | LFFHKTFRGDLLAG-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.25 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (5-methyl-2-propan-2-ylphenyl) 3-iodo-4-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-2-propan-2-ylphenyl) 3-iodo-4-methoxybenzoate?
The IUPAC name of (5-methyl-2-propan-2-ylphenyl) 3-iodo-4-methoxybenzoate (CID 23010933) is (5-methyl-2-propan-2-ylphenyl) 3-iodo-4-methoxybenzoate.
What is the SMILES notation for (5-methyl-2-propan-2-ylphenyl) 3-iodo-4-methoxybenzoate?
The canonical SMILES for (5-methyl-2-propan-2-ylphenyl) 3-iodo-4-methoxybenzoate is COc1ccc(C(=O)Oc2cc(C)ccc2C(C)C)cc1I.
What is the InChIKey of (5-methyl-2-propan-2-ylphenyl) 3-iodo-4-methoxybenzoate?
The InChIKey is LFFHKTFRGDLLAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19IO3/c1-11(2)14-7-5-12(3)9-17(14)22-18(20)13-6-8-16(21-4)15(19)10-13/h5-11H,1-4H3.
What are the key properties of (5-methyl-2-propan-2-ylphenyl) 3-iodo-4-methoxybenzoate?
(5-methyl-2-propan-2-ylphenyl) 3-iodo-4-methoxybenzoate has a molecular weight of 410.25 g/mol, XLogP of 4.95, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-2-propan-2-ylphenyl) 3-iodo-4-methoxybenzoate is sourced from PubChem (CID 23010933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).