About (1-bromonaphthalen-2-yl) 3-iodo-4-methoxybenzoate
(1-bromonaphthalen-2-yl) 3-iodo-4-methoxybenzoate (PubChem CID 23010939) has the molecular formula C18H12BrIO3
and a molecular weight of 483.10 g/mol. Its IUPAC name is (1-bromonaphthalen-2-yl) 3-iodo-4-methoxybenzoate.
Molecular Properties
| Compound Name | (1-bromonaphthalen-2-yl) 3-iodo-4-methoxybenzoate |
| PubChem CID | 23010939 |
| Molecular Formula | C18H12BrIO3 |
| Molecular Weight | 483.10 g/mol |
| Exact Mass | 481.90 |
| IUPAC Name | (1-bromonaphthalen-2-yl) 3-iodo-4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc3ccccc3c2Br)cc1I |
| InChI | InChI=1S/C18H12BrIO3/c1-22-15-8-7-12(10-14(15)20)18(21)23-16-9-6-11-4-2-3-5-13(11)17(16)19/h2-10H,1H3 |
| InChIKey | LHTLMNZWIKXDJS-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 483.10 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (1-bromonaphthalen-2-yl) 3-iodo-4-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-bromonaphthalen-2-yl) 3-iodo-4-methoxybenzoate?
The IUPAC name of (1-bromonaphthalen-2-yl) 3-iodo-4-methoxybenzoate (CID 23010939) is (1-bromonaphthalen-2-yl) 3-iodo-4-methoxybenzoate.
What is the SMILES notation for (1-bromonaphthalen-2-yl) 3-iodo-4-methoxybenzoate?
The canonical SMILES for (1-bromonaphthalen-2-yl) 3-iodo-4-methoxybenzoate is COc1ccc(C(=O)Oc2ccc3ccccc3c2Br)cc1I.
What is the InChIKey of (1-bromonaphthalen-2-yl) 3-iodo-4-methoxybenzoate?
The InChIKey is LHTLMNZWIKXDJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12BrIO3/c1-22-15-8-7-12(10-14(15)20)18(21)23-16-9-6-11-4-2-3-5-13(11)17(16)19/h2-10H,1H3.
What are the key properties of (1-bromonaphthalen-2-yl) 3-iodo-4-methoxybenzoate?
(1-bromonaphthalen-2-yl) 3-iodo-4-methoxybenzoate has a molecular weight of 483.10 g/mol, XLogP of 5.43, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-bromonaphthalen-2-yl) 3-iodo-4-methoxybenzoate is sourced from PubChem (CID 23010939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).