About (1-bromonaphthalen-2-yl) 4-(5-propyl-2-pyridinyl)benzoate
(1-bromonaphthalen-2-yl) 4-(5-propyl-2-pyridinyl)benzoate (PubChem CID 23732375) has the molecular formula C25H20BrNO2
and a molecular weight of 446.34 g/mol. Its IUPAC name is (1-bromonaphthalen-2-yl) 4-(5-propyl-2-pyridinyl)benzoate.
Molecular Properties
| Compound Name | (1-bromonaphthalen-2-yl) 4-(5-propyl-2-pyridinyl)benzoate |
| PubChem CID | 23732375 |
| Molecular Formula | C25H20BrNO2 |
| Molecular Weight | 446.34 g/mol |
| Exact Mass | 445.07 |
| IUPAC Name | (1-bromonaphthalen-2-yl) 4-(5-propyl-2-pyridinyl)benzoate |
| SMILES | CCCc1ccc(-c2ccc(C(=O)Oc3ccc4ccccc4c3Br)cc2)nc1 |
| InChI | InChI=1S/C25H20BrNO2/c1-2-5-17-8-14-22(27-16-17)19-9-11-20(12-10-19)25(28)29-23-15-13-18-6-3-4-7-21(18)24(23)26/h3-4,6-16H,2,5H2,1H3 |
| InChIKey | UTQYOIHQJMUVAE-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 446.34 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (1-bromonaphthalen-2-yl) 4-(5-propyl-2-pyridinyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-bromonaphthalen-2-yl) 4-(5-propyl-2-pyridinyl)benzoate?
The IUPAC name of (1-bromonaphthalen-2-yl) 4-(5-propyl-2-pyridinyl)benzoate (CID 23732375) is (1-bromonaphthalen-2-yl) 4-(5-propyl-2-pyridinyl)benzoate.
What is the SMILES notation for (1-bromonaphthalen-2-yl) 4-(5-propyl-2-pyridinyl)benzoate?
The canonical SMILES for (1-bromonaphthalen-2-yl) 4-(5-propyl-2-pyridinyl)benzoate is CCCc1ccc(-c2ccc(C(=O)Oc3ccc4ccccc4c3Br)cc2)nc1.
What is the InChIKey of (1-bromonaphthalen-2-yl) 4-(5-propyl-2-pyridinyl)benzoate?
The InChIKey is UTQYOIHQJMUVAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H20BrNO2/c1-2-5-17-8-14-22(27-16-17)19-9-11-20(12-10-19)25(28)29-23-15-13-18-6-3-4-7-21(18)24(23)26/h3-4,6-16H,2,5H2,1H3.
What are the key properties of (1-bromonaphthalen-2-yl) 4-(5-propyl-2-pyridinyl)benzoate?
(1-bromonaphthalen-2-yl) 4-(5-propyl-2-pyridinyl)benzoate has a molecular weight of 446.34 g/mol, XLogP of 6.84, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-bromonaphthalen-2-yl) 4-(5-propyl-2-pyridinyl)benzoate is sourced from PubChem (CID 23732375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).