C17H9Cl2IO2 — CID 2725721
(1-iodonaphthalen-2-yl) 3,4-dichlorobenzoate (PubChem CID 2725721) has the molecular formula C17H9Cl2IO2 and a molecular weight of 443.07 g/mol. Its IUPAC name is (1-iodonaphthalen-2-yl) 3,4-dichlorobenzoate.
| Compound Name | (1-iodonaphthalen-2-yl) 3,4-dichlorobenzoate |
|---|---|
| PubChem CID | 2725721 |
| Molecular Formula | C17H9Cl2IO2 |
| Molecular Weight | 443.07 g/mol |
| Exact Mass | 441.90 |
| IUPAC Name | (1-iodonaphthalen-2-yl) 3,4-dichlorobenzoate |
| SMILES | O=C(Oc1ccc2ccccc2c1I)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H9Cl2IO2/c18-13-7-5-11(9-14(13)19)17(21)22-15-8-6-10-3-1-2-4-12(10)16(15)20/h1-9H |
| InChIKey | AERNYZBWOXLBJC-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.07 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|