C17H10Cl2O2 — CID 7959552
(3,4-dichlorophenyl) naphthalene-2-carboxylate (PubChem CID 7959552) has the molecular formula C17H10Cl2O2 and a molecular weight of 317.17 g/mol. Its IUPAC name is (3,4-dichlorophenyl) naphthalene-2-carboxylate.
| Compound Name | (3,4-dichlorophenyl) naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 7959552 |
| Molecular Formula | C17H10Cl2O2 |
| Molecular Weight | 317.17 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | (3,4-dichlorophenyl) naphthalene-2-carboxylate |
| SMILES | O=C(Oc1ccc(Cl)c(Cl)c1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C17H10Cl2O2/c18-15-8-7-14(10-16(15)19)21-17(20)13-6-5-11-3-1-2-4-12(11)9-13/h1-10H |
| InChIKey | HRHGTVJPOMCWHQ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.17 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|