C14H7Cl3O3 — CID 91679824
(4-carbonochloridoylphenyl) 3,4-dichlorobenzoate (PubChem CID 91679824) has the molecular formula C14H7Cl3O3 and a molecular weight of 329.57 g/mol. Its IUPAC name is (4-carbonochloridoylphenyl) 3,4-dichlorobenzoate.
| Compound Name | (4-carbonochloridoylphenyl) 3,4-dichlorobenzoate |
|---|---|
| PubChem CID | 91679824 |
| Molecular Formula | C14H7Cl3O3 |
| Molecular Weight | 329.57 g/mol |
| Exact Mass | 327.95 |
| IUPAC Name | (4-carbonochloridoylphenyl) 3,4-dichlorobenzoate |
| SMILES | O=C(Cl)c1ccc(OC(=O)c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C14H7Cl3O3/c15-11-6-3-9(7-12(11)16)14(19)20-10-4-1-8(2-5-10)13(17)18/h1-7H |
| InChIKey | WKRZOEYINNNPGU-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.57 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|