C15H11BrCl2O2 — CID 19181611
(4-bromo-2,6-dimethylphenyl) 3,4-dichlorobenzoate (PubChem CID 19181611) has the molecular formula C15H11BrCl2O2 and a molecular weight of 374.06 g/mol. Its IUPAC name is (4-bromo-2,6-dimethylphenyl) 3,4-dichlorobenzoate.
| Compound Name | (4-bromo-2,6-dimethylphenyl) 3,4-dichlorobenzoate |
|---|---|
| PubChem CID | 19181611 |
| Molecular Formula | C15H11BrCl2O2 |
| Molecular Weight | 374.06 g/mol |
| Exact Mass | 371.93 |
| IUPAC Name | (4-bromo-2,6-dimethylphenyl) 3,4-dichlorobenzoate |
| SMILES | Cc1cc(Br)cc(C)c1OC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H11BrCl2O2/c1-8-5-11(16)6-9(2)14(8)20-15(19)10-3-4-12(17)13(18)7-10/h3-7H,1-2H3 |
| InChIKey | FONATRXDQQYPTI-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.06 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|