C16H14BrClO2 — CID 7920840
(4-bromo-2-chloro-6-methylphenyl) 2,5-dimethylbenzoate (PubChem CID 7920840) has the molecular formula C16H14BrClO2 and a molecular weight of 353.64 g/mol. Its IUPAC name is (4-bromo-2-chloro-6-methylphenyl) 2,5-dimethylbenzoate.
| Compound Name | (4-bromo-2-chloro-6-methylphenyl) 2,5-dimethylbenzoate |
|---|---|
| PubChem CID | 7920840 |
| Molecular Formula | C16H14BrClO2 |
| Molecular Weight | 353.64 g/mol |
| Exact Mass | 351.99 |
| IUPAC Name | (4-bromo-2-chloro-6-methylphenyl) 2,5-dimethylbenzoate |
| SMILES | Cc1ccc(C)c(C(=O)Oc2c(C)cc(Br)cc2Cl)c1 |
| InChI | InChI=1S/C16H14BrClO2/c1-9-4-5-10(2)13(6-9)16(19)20-15-11(3)7-12(17)8-14(15)18/h4-8H,1-3H3 |
| InChIKey | ABESYVANXSWFSU-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.64 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|