C18H16BrCl2NO4S — CID 3476440
(4-bromo-2-chloro-6-methylphenyl) 4-chloro-3-pyrrolidin-1-ylsulfonylbenzoate (PubChem CID 3476440) has the molecular formula C18H16BrCl2NO4S and a molecular weight of 493.21 g/mol. Its IUPAC name is (4-bromo-2-chloro-6-methylphenyl) 4-chloro-3-pyrrolidin-1-ylsulfonylbenzoate.
| Compound Name | (4-bromo-2-chloro-6-methylphenyl) 4-chloro-3-pyrrolidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 3476440 |
| Molecular Formula | C18H16BrCl2NO4S |
| Molecular Weight | 493.21 g/mol |
| Exact Mass | 490.94 |
| IUPAC Name | (4-bromo-2-chloro-6-methylphenyl) 4-chloro-3-pyrrolidin-1-ylsulfonylbenzoate |
| SMILES | Cc1cc(Br)cc(Cl)c1OC(=O)c1ccc(Cl)c(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C18H16BrCl2NO4S/c1-11-8-13(19)10-15(21)17(11)26-18(23)12-4-5-14(20)16(9-12)27(24,25)22-6-2-3-7-22/h4-5,8-10H,2-3,6-7H2,1H3 |
| InChIKey | GZBGLEJGZFKGHN-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.21 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|