C21H17Cl3N2O4S — CID 5137264
(5,7-dichloro-2-methylquinolin-8-yl) 4-chloro-3-pyrrolidin-1-ylsulfonylbenzoate (PubChem CID 5137264) has the molecular formula C21H17Cl3N2O4S and a molecular weight of 499.80 g/mol. Its IUPAC name is (5,7-dichloro-2-methylquinolin-8-yl) 4-chloro-3-pyrrolidin-1-ylsulfonylbenzoate.
| Compound Name | (5,7-dichloro-2-methylquinolin-8-yl) 4-chloro-3-pyrrolidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 5137264 |
| Molecular Formula | C21H17Cl3N2O4S |
| Molecular Weight | 499.80 g/mol |
| Exact Mass | 498.00 |
| IUPAC Name | (5,7-dichloro-2-methylquinolin-8-yl) 4-chloro-3-pyrrolidin-1-ylsulfonylbenzoate |
| SMILES | Cc1ccc2c(Cl)cc(Cl)c(OC(=O)c3ccc(Cl)c(S(=O)(=O)N4CCCC4)c3)c2n1 |
| InChI | InChI=1S/C21H17Cl3N2O4S/c1-12-4-6-14-16(23)11-17(24)20(19(14)25-12)30-21(27)13-5-7-15(22)18(10-13)31(28,29)26-8-2-3-9-26/h4-7,10-11H,2-3,8-9H2,1H3 |
| InChIKey | HWXHHOVANXFMOO-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.80 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|