C21H20Cl2N2O4S — CID 3896929
(5,7-dichloro-2-methylquinolin-8-yl) 3-(diethylsulfamoyl)benzoate (PubChem CID 3896929) has the molecular formula C21H20Cl2N2O4S and a molecular weight of 467.37 g/mol. Its IUPAC name is (5,7-dichloro-2-methylquinolin-8-yl) 3-(diethylsulfamoyl)benzoate.
| Compound Name | (5,7-dichloro-2-methylquinolin-8-yl) 3-(diethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 3896929 |
| Molecular Formula | C21H20Cl2N2O4S |
| Molecular Weight | 467.37 g/mol |
| Exact Mass | 466.05 |
| IUPAC Name | (5,7-dichloro-2-methylquinolin-8-yl) 3-(diethylsulfamoyl)benzoate |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(C(=O)Oc2c(Cl)cc(Cl)c3ccc(C)nc23)c1 |
| InChI | InChI=1S/C21H20Cl2N2O4S/c1-4-25(5-2)30(27,28)15-8-6-7-14(11-15)21(26)29-20-18(23)12-17(22)16-10-9-13(3)24-19(16)20/h6-12H,4-5H2,1-3H3 |
| InChIKey | BBIHYJZCBOTMNQ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.37 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|